Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
| CAS | 519-37-9 |
|---|
Butyl 4-hydroxybenzoate, 99+%
CAS: 94-26-8 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00016478 InChI Key: QFOHBWFCKVYLES-UHFFFAOYSA-N Synonym: butylparaben,butyl paraben,butyl p-hydroxybenzoate,nipabutyl,butoben,butyl chemosept,butyl parasept,butyl tegosept,butyl butex,tegosept butyl PubChem CID: 7184 IUPAC Name: butyl 4-hydroxybenzoate SMILES: CCCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7184 |
|---|---|
| CAS | 94-26-8 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00016478 |
| SMILES | CCCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | butylparaben,butyl paraben,butyl p-hydroxybenzoate,nipabutyl,butoben,butyl chemosept,butyl parasept,butyl tegosept,butyl butex,tegosept butyl |
| IUPAC Name | butyl 4-hydroxybenzoate |
| InChI Key | QFOHBWFCKVYLES-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
6,9-Diamino-2-ethoxyacridine lactate monohydrate, 95%, Thermo Scientific Chemicals
CAS: 6402-23-9 Molecular Formula: C3H6O3·H2O Molecular Weight (g/mol): 361.39 MDL Number: MFCD00149646 InChI Key: NYEPHMYJRNWPLA-UHFFFAOYSA-N Synonym: ethacridine lactate monohydrate,ethodin,ethacridine lactate hydrate,ethacridine lactate salt,dsstox_cid_26274,dsstox_rid_81501,dsstox_gsid_46274,7-ethoxyacridine-3,9-diamine; 2-hydroxypropanoic acid; hydrate,rivanol monohydrate PubChem CID: 165457 IUPAC Name: 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate SMILES: CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)N.CC(C(=O)O)O.O
| PubChem CID | 165457 |
|---|---|
| CAS | 6402-23-9 |
| Molecular Weight (g/mol) | 361.39 |
| MDL Number | MFCD00149646 |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)N.CC(C(=O)O)O.O |
| Synonym | ethacridine lactate monohydrate,ethodin,ethacridine lactate hydrate,ethacridine lactate salt,dsstox_cid_26274,dsstox_rid_81501,dsstox_gsid_46274,7-ethoxyacridine-3,9-diamine; 2-hydroxypropanoic acid; hydrate,rivanol monohydrate |
| IUPAC Name | 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate |
| InChI Key | NYEPHMYJRNWPLA-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3·H2O |
1,1,4,7,7-Pentamethyldiethylenetriamine, 98%
CAS: 3030-47-5 Molecular Formula: C9H23N3 Molecular Weight (g/mol): 173.304 MDL Number: MFCD00014876 InChI Key: UKODFQOELJFMII-UHFFFAOYSA-N Synonym: pentamethyldiethylenetriamine,1,1,4,7,7-pentamethyldiethylenetriamine,pmdt,n,n,n',n,n-pentamethyldiethylenetriamine,pmdeta,pmdta,pentamethyldiethylenetriaminek,bis 2-dimethylaminoethyl methyl amine,2,5,8-trimethyl-2,5,8-triazanonane,n,n',n-pentamethyldiethylenetriamine PubChem CID: 18196 ChEBI: CHEBI:39475 IUPAC Name: N'-[2-(dimethylamino)ethyl]-N,N,N'-trimethylethane-1,2-diamine SMILES: CN(C)CCN(C)CCN(C)C
| PubChem CID | 18196 |
|---|---|
| CAS | 3030-47-5 |
| Molecular Weight (g/mol) | 173.304 |
| ChEBI | CHEBI:39475 |
| MDL Number | MFCD00014876 |
| SMILES | CN(C)CCN(C)CCN(C)C |
| Synonym | pentamethyldiethylenetriamine,1,1,4,7,7-pentamethyldiethylenetriamine,pmdt,n,n,n',n,n-pentamethyldiethylenetriamine,pmdeta,pmdta,pentamethyldiethylenetriaminek,bis 2-dimethylaminoethyl methyl amine,2,5,8-trimethyl-2,5,8-triazanonane,n,n',n-pentamethyldiethylenetriamine |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N,N,N'-trimethylethane-1,2-diamine |
| InChI Key | UKODFQOELJFMII-UHFFFAOYSA-N |
| Molecular Formula | C9H23N3 |
Benzoic anhydride, 98%
CAS: 93-97-0 Molecular Formula: C14H10O3 Molecular Weight (g/mol): 226.231 MDL Number: MFCD00003073 InChI Key: CHIHQLCVLOXUJW-UHFFFAOYSA-N Synonym: benzoic anhydride,benzoic acid, anhydride,benzoyl anhydride,benzoylbenzoate,benzoic acid anhydride,benzoic acid, 1,1'-anhydride,phenyl anhydride,benzoesaeureanhydrid,unii-9k7x34fov2,phenylcarbonyl benzoate PubChem CID: 7167 ChEBI: CHEBI:38815 IUPAC Name: benzoyl benzoate SMILES: C1=CC=C(C=C1)C(=O)OC(=O)C2=CC=CC=C2
| PubChem CID | 7167 |
|---|---|
| CAS | 93-97-0 |
| Molecular Weight (g/mol) | 226.231 |
| ChEBI | CHEBI:38815 |
| MDL Number | MFCD00003073 |
| SMILES | C1=CC=C(C=C1)C(=O)OC(=O)C2=CC=CC=C2 |
| Synonym | benzoic anhydride,benzoic acid, anhydride,benzoyl anhydride,benzoylbenzoate,benzoic acid anhydride,benzoic acid, 1,1'-anhydride,phenyl anhydride,benzoesaeureanhydrid,unii-9k7x34fov2,phenylcarbonyl benzoate |
| IUPAC Name | benzoyl benzoate |
| InChI Key | CHIHQLCVLOXUJW-UHFFFAOYSA-N |
| Molecular Formula | C14H10O3 |
4-Chlorobenzoic acid, 98+%
CAS: 74-11-3 Molecular Formula: C7H5ClO2 Molecular Weight (g/mol): 156.565 MDL Number: MFCD00002531 InChI Key: XRHGYUZYPHTUJZ-UHFFFAOYSA-N Synonym: p-chlorobenzoic acid,benzoic acid, 4-chloro,p-chlorbenzoic acid,chlorodracylic acid,benzoic acid, p-chloro,para-chlorobenzoic acid,4-chloro-benzoic acid,p-carboxychlorobenzene,acido p-clorobenzoico,acido p-clorobenzoico italian PubChem CID: 6318 ChEBI: CHEBI:30747 IUPAC Name: 4-chlorobenzoic acid SMILES: C1=CC(=CC=C1C(=O)O)Cl
| PubChem CID | 6318 |
|---|---|
| CAS | 74-11-3 |
| Molecular Weight (g/mol) | 156.565 |
| ChEBI | CHEBI:30747 |
| MDL Number | MFCD00002531 |
| SMILES | C1=CC(=CC=C1C(=O)O)Cl |
| Synonym | p-chlorobenzoic acid,benzoic acid, 4-chloro,p-chlorbenzoic acid,chlorodracylic acid,benzoic acid, p-chloro,para-chlorobenzoic acid,4-chloro-benzoic acid,p-carboxychlorobenzene,acido p-clorobenzoico,acido p-clorobenzoico italian |
| IUPAC Name | 4-chlorobenzoic acid |
| InChI Key | XRHGYUZYPHTUJZ-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO2 |
Methyltriphenylphosphonium bromide, 98+%
CAS: 1779-49-3 Molecular Formula: C19H18BrP Molecular Weight (g/mol): 357.23 MDL Number: MFCD00011804 InChI Key: LSEFCHWGJNHZNT-UHFFFAOYSA-M Synonym: methyltriphenylphosphonium bromide,methyltriphenylphosphanium bromide,triphenylmethylphosphonium bromide,methyl triphenylphosphonium bromide,methyl triphenyl phosphonium bromide,phosphonium, methyltriphenyl-, bromide,methyltriphenylphosphoniumbromide,methyl-triphenyl-phosphonium bromide PubChem CID: 74505 IUPAC Name: methyl(triphenyl)phosphanium;bromide SMILES: [Br-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 74505 |
|---|---|
| CAS | 1779-49-3 |
| Molecular Weight (g/mol) | 357.23 |
| MDL Number | MFCD00011804 |
| SMILES | [Br-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyltriphenylphosphonium bromide,methyltriphenylphosphanium bromide,triphenylmethylphosphonium bromide,methyl triphenylphosphonium bromide,methyl triphenyl phosphonium bromide,phosphonium, methyltriphenyl-, bromide,methyltriphenylphosphoniumbromide,methyl-triphenyl-phosphonium bromide |
| IUPAC Name | methyl(triphenyl)phosphanium;bromide |
| InChI Key | LSEFCHWGJNHZNT-UHFFFAOYSA-M |
| Molecular Formula | C19H18BrP |
4-Bromobenzotrifluoride, 99%
CAS: 402-43-7 Molecular Formula: C7H4BrF3 Molecular Weight (g/mol): 225.008 MDL Number: MFCD00000398 InChI Key: XLQSXGGDTHANLN-UHFFFAOYSA-N Synonym: 4-bromobenzotrifluoride,1-bromo-4-trifluoromethyl benzene,benzene, 1-bromo-4-trifluoromethyl,p-bromobenzotrifluoride,4-bromotrifluorotoluene,4-bromo-alpha,alpha,alpha-trifluorotoluene,p-bromotrifluoromethylbenzene,4-trifluoromethyl bromobenzene,4-bromo-a,a,a-trifluorotoluene,4-trifluoromethylbromobenzene PubChem CID: 67872 IUPAC Name: 1-bromo-4-(trifluoromethyl)benzene SMILES: C1=CC(=CC=C1C(F)(F)F)Br
| PubChem CID | 67872 |
|---|---|
| CAS | 402-43-7 |
| Molecular Weight (g/mol) | 225.008 |
| MDL Number | MFCD00000398 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)Br |
| Synonym | 4-bromobenzotrifluoride,1-bromo-4-trifluoromethyl benzene,benzene, 1-bromo-4-trifluoromethyl,p-bromobenzotrifluoride,4-bromotrifluorotoluene,4-bromo-alpha,alpha,alpha-trifluorotoluene,p-bromotrifluoromethylbenzene,4-trifluoromethyl bromobenzene,4-bromo-a,a,a-trifluorotoluene,4-trifluoromethylbromobenzene |
| IUPAC Name | 1-bromo-4-(trifluoromethyl)benzene |
| InChI Key | XLQSXGGDTHANLN-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrF3 |
2,5-Dibromotoluene, 98%
CAS: 615-59-8 Molecular Formula: C7H6Br2 Molecular Weight (g/mol): 249.933 MDL Number: MFCD00000090 InChI Key: QKEZTJYRBHOKHH-UHFFFAOYSA-N Synonym: 2,5-dibromotoluene,benzene, 1,4-dibromo-2-methyl,toluene, 2,5-dibromo,2,5-dibromo toluene,3,6-dibromotoluene,1,4-dibromo-2-methyl-benzene,pubchem3922,acmc-209mu2,chemwish ic06904 PubChem CID: 12006 IUPAC Name: 1,4-dibromo-2-methylbenzene SMILES: CC1=C(C=CC(=C1)Br)Br
| PubChem CID | 12006 |
|---|---|
| CAS | 615-59-8 |
| Molecular Weight (g/mol) | 249.933 |
| MDL Number | MFCD00000090 |
| SMILES | CC1=C(C=CC(=C1)Br)Br |
| Synonym | 2,5-dibromotoluene,benzene, 1,4-dibromo-2-methyl,toluene, 2,5-dibromo,2,5-dibromo toluene,3,6-dibromotoluene,1,4-dibromo-2-methyl-benzene,pubchem3922,acmc-209mu2,chemwish ic06904 |
| IUPAC Name | 1,4-dibromo-2-methylbenzene |
| InChI Key | QKEZTJYRBHOKHH-UHFFFAOYSA-N |
| Molecular Formula | C7H6Br2 |
1-Iodonaphthalene, 98%
CAS: 90-14-2 Molecular Formula: C10H7I Molecular Weight (g/mol): 254.07 MDL Number: MFCD00003876 InChI Key: NHPPIJMARIVBGU-UHFFFAOYSA-N Synonym: naphthalene, 1-iodo,1-naphthyl iodide,alpha-iodonaphthalene,iodonaphthalene,1-iodonaphthalenen,.alpha.-iodonaphthalene,1-iodo-naphthalene,1-iodonaphthlen,1-iodonaphthlene,1-iodonapthalene PubChem CID: 7004 IUPAC Name: 1-iodonaphthalene SMILES: C1=CC=C2C(=C1)C=CC=C2I
| PubChem CID | 7004 |
|---|---|
| CAS | 90-14-2 |
| Molecular Weight (g/mol) | 254.07 |
| MDL Number | MFCD00003876 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2I |
| Synonym | naphthalene, 1-iodo,1-naphthyl iodide,alpha-iodonaphthalene,iodonaphthalene,1-iodonaphthalenen,.alpha.-iodonaphthalene,1-iodo-naphthalene,1-iodonaphthlen,1-iodonaphthlene,1-iodonapthalene |
| IUPAC Name | 1-iodonaphthalene |
| InChI Key | NHPPIJMARIVBGU-UHFFFAOYSA-N |
| Molecular Formula | C10H7I |
Perfluorodecanoic acid, 97%
CAS: 335-76-2 Molecular Formula: C10HF19O2 Molecular Weight (g/mol): 514.09 MDL Number: MFCD00004175 InChI Key: PCIUEQPBYFRTEM-UHFFFAOYSA-N Synonym: perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid PubChem CID: 9555 ChEBI: CHEBI:35546 IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid SMILES: OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 9555 |
|---|---|
| CAS | 335-76-2 |
| Molecular Weight (g/mol) | 514.09 |
| ChEBI | CHEBI:35546 |
| MDL Number | MFCD00004175 |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid |
| InChI Key | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| Molecular Formula | C10HF19O2 |
2,2-Bis(hydroxymethyl)-2,2',2″-nitrilotriethanol, 98%
CAS: 6976-37-0 Molecular Formula: C8H19NO5 Molecular Weight (g/mol): 209.242 MDL Number: MFCD00002853 InChI Key: OWMVSZAMULFTJU-UHFFFAOYSA-N Synonym: bis-tris,bistris,2,2-bis hydroxymethyl-2,2',2-nitrilotriethanol,bis 2-hydroxyethyl aminotris hydroxymethyl methane,bis-tris buffer,1,3-propanediol, 2-bis 2-hydroxyethyl amino-2-hydroxymethyl,unii-q1xc3631cp,bis 2-hydroxyethyl amino-tris hydroxymethyl methane,2-bis 2-hydroxyethyl amino-2-hydroxymethyl propane-1,3-diol,bis 2-hydroxyethyl iminotris hydroxymethyl methane PubChem CID: 81462 ChEBI: CHEBI:41250 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol SMILES: C(CO)N(CCO)C(CO)(CO)CO
| PubChem CID | 81462 |
|---|---|
| CAS | 6976-37-0 |
| Molecular Weight (g/mol) | 209.242 |
| ChEBI | CHEBI:41250 |
| MDL Number | MFCD00002853 |
| SMILES | C(CO)N(CCO)C(CO)(CO)CO |
| Synonym | bis-tris,bistris,2,2-bis hydroxymethyl-2,2',2-nitrilotriethanol,bis 2-hydroxyethyl aminotris hydroxymethyl methane,bis-tris buffer,1,3-propanediol, 2-bis 2-hydroxyethyl amino-2-hydroxymethyl,unii-q1xc3631cp,bis 2-hydroxyethyl amino-tris hydroxymethyl methane,2-bis 2-hydroxyethyl amino-2-hydroxymethyl propane-1,3-diol,bis 2-hydroxyethyl iminotris hydroxymethyl methane |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | OWMVSZAMULFTJU-UHFFFAOYSA-N |
| Molecular Formula | C8H19NO5 |
4-Fluoro-2-methylphenylmagnesium bromide, 0.50 M in 2-MeTHF
CAS: 30897-90-6 Molecular Formula: C7H6BrFMg Molecular Weight (g/mol): 213.33 MDL Number: MFCD01311469 InChI Key: SWSQUPDDGGYHLR-UHFFFAOYSA-M Synonym: 4-fluoro-2-methylphenylmagnesium bromide,bromo 4-fluoro-2-methylphenyl magnesium,swsqupddggyhlr-uhfffaoysa-m,4-fluoro-2-methylphenyl magnesium bromide,4-fluoro-2-methyl-phenyl magnesium bromide,4-fluoro-2-methylphenylmagnesium bromide, 0.50 m in 2-methf,4-fluoro-2-methylphenylmagnesium bromide 0.5 m in tetrahydrofuran,4-fluoro-2-methylphenylmagnesium bromide solution, 0.5 m in thf,grignard reagent PubChem CID: 2778803 IUPAC Name: magnesium;1-fluoro-3-methylbenzene-4-ide;bromide SMILES: CC1=CC(F)=CC=C1[Mg]Br
| PubChem CID | 2778803 |
|---|---|
| CAS | 30897-90-6 |
| Molecular Weight (g/mol) | 213.33 |
| MDL Number | MFCD01311469 |
| SMILES | CC1=CC(F)=CC=C1[Mg]Br |
| Synonym | 4-fluoro-2-methylphenylmagnesium bromide,bromo 4-fluoro-2-methylphenyl magnesium,swsqupddggyhlr-uhfffaoysa-m,4-fluoro-2-methylphenyl magnesium bromide,4-fluoro-2-methyl-phenyl magnesium bromide,4-fluoro-2-methylphenylmagnesium bromide, 0.50 m in 2-methf,4-fluoro-2-methylphenylmagnesium bromide 0.5 m in tetrahydrofuran,4-fluoro-2-methylphenylmagnesium bromide solution, 0.5 m in thf,grignard reagent |
| IUPAC Name | magnesium;1-fluoro-3-methylbenzene-4-ide;bromide |
| InChI Key | SWSQUPDDGGYHLR-UHFFFAOYSA-M |
| Molecular Formula | C7H6BrFMg |
4-Bromo-3-chlorobenzoic acid, 97%
CAS: 25118-59-6 Molecular Formula: C7H4BrClO2 Molecular Weight (g/mol): 235.46 MDL Number: MFCD08276864 InChI Key: PSKJIHDVFDVNBU-UHFFFAOYSA-N Synonym: benzoic acid, 4-bromo-3-chloro,acmc-1cbza,intermediates-zcf02677,ksc201k8d,3-chloro-4-bromobenzoic acid,4-bromo-3-chloro-benzoic acid,3-chloro-4-bromor-benzoic acid,benzoicacid, 4-bromo-3-chloro,4-bromanyl-3-chloranyl-benzoic acid,4-bromo-3-chlorobenzoic acid PubChem CID: 12594302 IUPAC Name: 4-bromo-3-chlorobenzoic acid SMILES: OC(=O)C1=CC(Cl)=C(Br)C=C1
| PubChem CID | 12594302 |
|---|---|
| CAS | 25118-59-6 |
| Molecular Weight (g/mol) | 235.46 |
| MDL Number | MFCD08276864 |
| SMILES | OC(=O)C1=CC(Cl)=C(Br)C=C1 |
| Synonym | benzoic acid, 4-bromo-3-chloro,acmc-1cbza,intermediates-zcf02677,ksc201k8d,3-chloro-4-bromobenzoic acid,4-bromo-3-chloro-benzoic acid,3-chloro-4-bromor-benzoic acid,benzoicacid, 4-bromo-3-chloro,4-bromanyl-3-chloranyl-benzoic acid,4-bromo-3-chlorobenzoic acid |
| IUPAC Name | 4-bromo-3-chlorobenzoic acid |
| InChI Key | PSKJIHDVFDVNBU-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrClO2 |
3-Bromo-4-nitrobenzoic acid, 97%
CAS: 101420-81-9 Molecular Formula: C7H4BrNO4 Molecular Weight (g/mol): 246.02 MDL Number: MFCD04117949 InChI Key: KKPPNEJUUOQRLE-UHFFFAOYSA-N Synonym: 3-bromo-4-nitrobenzoic acid,3-bromo-4-nitrobenzoicacid,benzoic acid,3-bromo-4-nitro,benzoic acid, 3-bromo-4-nitro,3-bromo-4-nitrobenzoic acid 97,pubchem16301,acmc-209x3e,4-nitro-3-bromobenzoic acid,3-bromo-4-nitro-benzoic acid PubChem CID: 16218087 IUPAC Name: 3-bromo-4-nitrobenzoic acid SMILES: OC(=O)C1=CC(Br)=C(C=C1)[N+]([O-])=O
| PubChem CID | 16218087 |
|---|---|
| CAS | 101420-81-9 |
| Molecular Weight (g/mol) | 246.02 |
| MDL Number | MFCD04117949 |
| SMILES | OC(=O)C1=CC(Br)=C(C=C1)[N+]([O-])=O |
| Synonym | 3-bromo-4-nitrobenzoic acid,3-bromo-4-nitrobenzoicacid,benzoic acid,3-bromo-4-nitro,benzoic acid, 3-bromo-4-nitro,3-bromo-4-nitrobenzoic acid 97,pubchem16301,acmc-209x3e,4-nitro-3-bromobenzoic acid,3-bromo-4-nitro-benzoic acid |
| IUPAC Name | 3-bromo-4-nitrobenzoic acid |
| InChI Key | KKPPNEJUUOQRLE-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrNO4 |